CAS 1451194-34-5 is the registry number for Vilazodone Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-chloro-1-hydroxybutyl)-1H-indole-5-carbonitrile (CAS 1451194-34-5) is a chemical compound with the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. IUPAC name: 3-(4-chloro-1-hydroxybutyl)-1H-indole-5-carbonitrile. InChIKey: COVHAQWURSFDTL-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O |
|---|---|
| Molecular weight | 248.71 g/mol |
| IUPAC name | 3-(4-chloro-1-hydroxybutyl)-1H-indole-5-carbonitrile |
| InChIKey | COVHAQWURSFDTL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)C(=CN2)C(CCCCl)O |
Computed by PubChem (NCBI)