Products 1451391-18-6
CAS 1451391-18-6 appears in our catalog under these names: 2,5-Dibromo-4-pyridinylboronic acid pinacol ester, 95%, 2,5-Dibromo-4-pyridinylboronic acid pinacol ester. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
2,5-dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1451391-18-6) is a chemical compound with the molecular formula C11H14BBr2NO2 and a molecular weight of 362.86 g/mol. IUPAC name: 2,5-dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: FBSPTENMODNNGF-UHFFFAOYSA-N.
| Molecular formula | C11H14BBr2NO2 |
|---|---|
| Molecular weight | 362.86 g/mol |
| IUPAC name | 2,5-dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | FBSPTENMODNNGF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2Br)Br |
Computed by PubChem (NCBI)