Products 852228-17-2
CAS 852228-17-2 is the registry number for 2,5-Dibromopyridine-3-boronic acid pinacol ester. Offered by: Fluorochem. Available pack sizes: 1g.
2,5-dibromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 852228-17-2) is a chemical compound with the molecular formula C11H14BBr2NO2 and a molecular weight of 362.86 g/mol. IUPAC name: 2,5-dibromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: KQFUAFHXDIYFFH-UHFFFAOYSA-N.
| Molecular formula | C11H14BBr2NO2 |
|---|---|
| Molecular weight | 362.86 g/mol |
| IUPAC name | 2,5-dibromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | KQFUAFHXDIYFFH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2Br)Br |
Computed by PubChem (NCBI)