Products 2064225-87-0
CAS 2064225-87-0 is the registry number for 3,5-Dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
3,5-dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2064225-87-0) is a chemical compound with the molecular formula C11H14BBr2NO2 and a molecular weight of 362.86 g/mol. IUPAC name: 3,5-dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: QEXYPVKJJSCBPW-UHFFFAOYSA-N.
| Molecular formula | C11H14BBr2NO2 |
|---|---|
| Molecular weight | 362.86 g/mol |
| IUPAC name | 3,5-dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | QEXYPVKJJSCBPW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NC=C2Br)Br |
Computed by PubChem (NCBI)