Products 957120-28-4
CAS 957120-28-4 appears in our catalog under these names: (6-Bromo-2-chloro-3-methylphenyl)boronic acid, 98%, 6-Bromo-2-chloro-3-methylphenylboronic acid, 98%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 5g, 250mg.
(6-bromo-2-chloro-3-methylphenyl)boronic acid (CAS 957120-28-4) is a chemical compound with the molecular formula C7H7BBrClO2 and a molecular weight of 249.30 g/mol. IUPAC name: (6-bromo-2-chloro-3-methylphenyl)boronic acid. InChIKey: PULIDPRGYYCQEZ-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrClO2 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | (6-bromo-2-chloro-3-methylphenyl)boronic acid |
| InChIKey | PULIDPRGYYCQEZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)C)Br)(O)O |
Computed by PubChem (NCBI)