CAS 1451391-88-0 appears in our catalog under these names: 2-Fluoro-3-(n,n-dimethylaminocarbonyl)phenylboronic acid, 95%, (3-(Dimethylcarbamoyl)-2-fluorophenyl)boronic acid, 95+%, (3-(Dimethylcarbamoyl)-2-fluorophenyl)boronic acid, ≥95%, ≥95%, 2-Fluoro-3-(N,N-dimethylaminocarbonyl)phenylboronic acid, >=95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
[3-(dimethylcarbamoyl)-2-fluorophenyl]boronic acid (CAS 1451391-88-0) is a chemical compound with the molecular formula C9H11BFNO3 and a molecular weight of 211.00 g/mol. IUPAC name: [3-(dimethylcarbamoyl)-2-fluorophenyl]boronic acid. InChIKey: ICJWWRWLFPUVJI-UHFFFAOYSA-N.
| Molecular formula | C9H11BFNO3 |
|---|---|
| Molecular weight | 211.00 g/mol |
| IUPAC name | [3-(dimethylcarbamoyl)-2-fluorophenyl]boronic acid |
| InChIKey | ICJWWRWLFPUVJI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(=O)N(C)C)F)(O)O |
Computed by PubChem (NCBI)