Products 2121512-56-7

CAS 2121512-56-7 is the registry number for 3,4-Dichloro-2-formylphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

(3,4-dichloro-2-formylphenyl)boronic acid (CAS 2121512-56-7) is a chemical compound with the molecular formula C7H5BCl2O3 and a molecular weight of 218.83 g/mol. IUPAC name: (3,4-dichloro-2-formylphenyl)boronic acid. InChIKey: ODOJGKPUZLBREY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BCl2O3
Molecular weight218.83 g/mol
IUPAC name(3,4-dichloro-2-formylphenyl)boronic acid
InChIKeyODOJGKPUZLBREY-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)Cl)Cl)C=O)(O)O

Computed by PubChem (NCBI)