Products 1451393-10-4

CAS 1451393-10-4 appears in our catalog under these names: 6-Chloro-2-fluoro-3-formylphenylboronic acid, 95%, (6-Chloro-2-fluoro-3-formylphenyl)boronic acid, 98+%, 6-Chloro-2-fluoro-3-formylphenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

(6-chloro-2-fluoro-3-formylphenyl)boronic acid (CAS 1451393-10-4) is a chemical compound with the molecular formula C7H5BClFO3 and a molecular weight of 202.38 g/mol. IUPAC name: (6-chloro-2-fluoro-3-formylphenyl)boronic acid. InChIKey: JJZRXCSZTZDMPC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BClFO3
Molecular weight202.38 g/mol
IUPAC name(6-chloro-2-fluoro-3-formylphenyl)boronic acid
InChIKeyJJZRXCSZTZDMPC-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1F)C=O)Cl)(O)O

Computed by PubChem (NCBI)