Products 2121514-97-2
CAS 2121514-97-2 appears in our catalog under these names: 2-Chloro-3-fluoro-4-formylphenylboronic acid, 2-Chloro-3-fluoro-4-formylphenylboronic acid, 95%, (2-Chloro-3-fluoro-4-formylphenyl)boronic acid, 98%. Offered by: Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg.
(2-chloro-3-fluoro-4-formylphenyl)boronic acid (CAS 2121514-97-2) is a chemical compound with the molecular formula C7H5BClFO3 and a molecular weight of 202.38 g/mol. IUPAC name: (2-chloro-3-fluoro-4-formylphenyl)boronic acid. InChIKey: USTVSJJGJJZPBC-UHFFFAOYSA-N.
| Molecular formula | C7H5BClFO3 |
|---|---|
| Molecular weight | 202.38 g/mol |
| IUPAC name | (2-chloro-3-fluoro-4-formylphenyl)boronic acid |
| InChIKey | USTVSJJGJJZPBC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C=O)F)Cl)(O)O |
Computed by PubChem (NCBI)