Products 325786-27-4
CAS 325786-27-4 is the registry number for (4-Chloro-2-fluoro-5-formylphenyl)boronic acid, 95%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
(4-chloro-2-fluoro-5-formylphenyl)boronic acid (CAS 325786-27-4) is a chemical compound with the molecular formula C7H5BClFO3 and a molecular weight of 202.38 g/mol. IUPAC name: (4-chloro-2-fluoro-5-formylphenyl)boronic acid. InChIKey: OOTMYKBNPFCNBY-UHFFFAOYSA-N.
| Molecular formula | C7H5BClFO3 |
|---|---|
| Molecular weight | 202.38 g/mol |
| IUPAC name | (4-chloro-2-fluoro-5-formylphenyl)boronic acid |
| InChIKey | OOTMYKBNPFCNBY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)Cl)C=O)(O)O |
Computed by PubChem (NCBI)