CAS 145159-59-7 is the registry number for Indolin-5-yldimethylphosphine oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-dimethylphosphoryl-2,3-dihydro-1H-indole (CAS 145159-59-7) is a chemical compound with the molecular formula C10H14NOP and a molecular weight of 195.20 g/mol. IUPAC name: 5-dimethylphosphoryl-2,3-dihydro-1H-indole. InChIKey: XPMDYRNKFZHIIZ-UHFFFAOYSA-N.
| Molecular formula | C10H14NOP |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 5-dimethylphosphoryl-2,3-dihydro-1H-indole |
| InChIKey | XPMDYRNKFZHIIZ-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1=CC2=C(C=C1)NCC2 |
Computed by PubChem (NCBI)