CAS 2634647-68-8 is the registry number for (4-Aminobicyclo[4.2.0]octa-1(6),2,4-trien-3-yl)dimethylphosphine oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-dimethylphosphorylbicyclo[4.2.0]octa-1,3,5-trien-3-amine (CAS 2634647-68-8) is a chemical compound with the molecular formula C10H14NOP and a molecular weight of 195.20 g/mol. IUPAC name: 4-dimethylphosphorylbicyclo[4.2.0]octa-1,3,5-trien-3-amine. InChIKey: WLAMEWCYEKXVMW-UHFFFAOYSA-N.
| Molecular formula | C10H14NOP |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 4-dimethylphosphorylbicyclo[4.2.0]octa-1,3,5-trien-3-amine |
| InChIKey | WLAMEWCYEKXVMW-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1=C(C=C2CCC2=C1)N |
Computed by PubChem (NCBI)