CAS 945460-44-6 appears in our catalog under these names: 4-Phenyl-1,4-azaphosphinane 4-oxide, 95%, 4-Phenyl-1,4λâµ-azaphosphinan-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-phenyl-1,4lambda5-azaphosphinane 4-oxide (CAS 945460-44-6) is a chemical compound with the molecular formula C10H14NOP and a molecular weight of 195.20 g/mol. IUPAC name: 4-phenyl-1,4lambda5-azaphosphinane 4-oxide. InChIKey: GBGBYLHZZQIYJD-UHFFFAOYSA-N.
| Molecular formula | C10H14NOP |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 4-phenyl-1,4lambda5-azaphosphinane 4-oxide |
| InChIKey | GBGBYLHZZQIYJD-UHFFFAOYSA-N |
| SMILES | C1CP(=O)(CCN1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)