CAS 1453252-65-7 is the registry number for tert-butyl (1S,5S,6s)-6-Amino-3-azabicyclo(3.1.0)hexane-3-carboxylate, 97+%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (1R,5S)-6-amino-3-azabicyclo[3.1.0]hexane-3-carboxylate (CAS 1453252-65-7) is a chemical compound with the molecular formula C10H18N2O2 and a molecular weight of 198.26 g/mol. IUPAC name: tert-butyl (1R,5S)-6-amino-3-azabicyclo[3.1.0]hexane-3-carboxylate. InChIKey: UWWZMHWHRBGMIT-DHBOJHSNSA-N.
| Molecular formula | C10H18N2O2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | tert-butyl (1R,5S)-6-amino-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | UWWZMHWHRBGMIT-DHBOJHSNSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2[C@H](C1)C2N |
Computed by PubChem (NCBI)