Products 145335-88-2

CAS 145335-88-2 is the registry number for 6-Chloroimidazo[1,2-a]pyridine-8-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

6-chloroimidazo[1,2-a]pyridine-8-carboxylic acid (CAS 145335-88-2) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 6-chloroimidazo[1,2-a]pyridine-8-carboxylic acid. InChIKey: ZNRWXIJAFJJYPI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClN2O2
Molecular weight196.59 g/mol
IUPAC name6-chloroimidazo[1,2-a]pyridine-8-carboxylic acid
InChIKeyZNRWXIJAFJJYPI-UHFFFAOYSA-N
SMILESC1=CN2C=C(C=C(C2=N1)C(=O)O)Cl

Computed by PubChem (NCBI)