CAS 145335-88-2 is the registry number for 6-Chloroimidazo[1,2-a]pyridine-8-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.
6-chloroimidazo[1,2-a]pyridine-8-carboxylic acid (CAS 145335-88-2) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 6-chloroimidazo[1,2-a]pyridine-8-carboxylic acid. InChIKey: ZNRWXIJAFJJYPI-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 6-chloroimidazo[1,2-a]pyridine-8-carboxylic acid |
| InChIKey | ZNRWXIJAFJJYPI-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=C(C2=N1)C(=O)O)Cl |
Computed by PubChem (NCBI)