Products 145337-55-9
CAS 145337-55-9 appears in our catalog under these names: Ro 31-9790, 98.93%, 98.93%, Ro 31-9790, 99.36%, Ro 31-9790 (Standard). Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 25 mg, 10mM/1mL, 10 mg, 100 mg, 5 mg, 50 mg.
(2R)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide (CAS 145337-55-9) is a chemical compound with the molecular formula C15H29N3O4 and a molecular weight of 315.41 g/mol. IUPAC name: (2R)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide. InChIKey: QRXOZHSEEGNRFC-ZYHUDNBSSA-N.
| Molecular formula | C15H29N3O4 |
|---|---|
| Molecular weight | 315.41 g/mol |
| IUPAC name | (2R)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
| InChIKey | QRXOZHSEEGNRFC-ZYHUDNBSSA-N |
| SMILES | CC(C)C[C@H](CC(=O)NO)C(=O)N[C@H](C(=O)NC)C(C)(C)C |
Computed by PubChem (NCBI)