CAS 1932411-32-9 appears in our catalog under these names: Di–tert–butyl (R)–2–(aminomethyl)piperazine–1,4–dicarboxylate, Di-tert-butyl (R)-2-(aminomethyl)piperazine-1,4-dicarboxylate 97%, Di-tert-butyl (R)-2-(aminomethyl)piperazine-1,4-dicarboxylate, 97%, 97%, Di-tert-butyl (R)-2-(aminomethyl)piperazine-1,4-dicarboxylate, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
Ditert-butyl (2R)-2-(aminomethyl)piperazine-1,4-dicarboxylate (CAS 1932411-32-9) is a chemical compound with the molecular formula C15H29N3O4 and a molecular weight of 315.41 g/mol. IUPAC name: ditert-butyl (2R)-2-(aminomethyl)piperazine-1,4-dicarboxylate. InChIKey: XJELTUFOFGNOTB-LLVKDONJSA-N.
| Molecular formula | C15H29N3O4 |
|---|---|
| Molecular weight | 315.41 g/mol |
| IUPAC name | ditert-butyl (2R)-2-(aminomethyl)piperazine-1,4-dicarboxylate |
| InChIKey | XJELTUFOFGNOTB-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@@H](C1)CN)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)