CAS 849160-51-6 is the registry number for rel-Di-tert-butyl (3R,5S)-piperidine-3,5-diyldicarbamate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl N-[(3R,5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]carbamate (CAS 849160-51-6) is a chemical compound with the molecular formula C15H29N3O4 and a molecular weight of 315.41 g/mol. IUPAC name: tert-butyl N-[(3R,5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]carbamate. InChIKey: IFULEBNOBLLOKS-PHIMTYICSA-N.
| Molecular formula | C15H29N3O4 |
|---|---|
| Molecular weight | 315.41 g/mol |
| IUPAC name | tert-butyl N-[(3R,5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]carbamate |
| InChIKey | IFULEBNOBLLOKS-PHIMTYICSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H](CNC1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)