CAS 145354-80-9 is the registry number for (alpha4R,2S,4S)-alpha4-(Hydroxymethyl)-1,3-dioxolane-2,4-dimethanol alpha2-Benzoate. Offered by: TRC. Available pack sizes: 250mg.
[(2S,4S)-4-[(1R)-1,2-dihydroxyethyl]-1,3-dioxolan-2-yl]methyl benzoate (CAS 145354-80-9) is a chemical compound with the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. IUPAC name: [(2S,4S)-4-[(1R)-1,2-dihydroxyethyl]-1,3-dioxolan-2-yl]methyl benzoate. InChIKey: GTVCILPJTFEAPF-WOPDTQHZSA-N.
| Molecular formula | C13H16O6 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | [(2S,4S)-4-[(1R)-1,2-dihydroxyethyl]-1,3-dioxolan-2-yl]methyl benzoate |
| InChIKey | GTVCILPJTFEAPF-WOPDTQHZSA-N |
| SMILES | C1[C@H](O[C@H](O1)COC(=O)C2=CC=CC=C2)[C@@H](CO)O |
Computed by PubChem (NCBI)