CAS 145547-97-3 appears in our catalog under these names: (4-Bromo-3-nitrophenyl)methanol, 4-Bromo-3-nitrobenzyl alcohol, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
(4-bromo-3-nitrophenyl)methanol (CAS 145547-97-3) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: (4-bromo-3-nitrophenyl)methanol. InChIKey: GAANESYOLGFJFC-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | (4-bromo-3-nitrophenyl)methanol |
| InChIKey | GAANESYOLGFJFC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CO)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)