CAS 145657-14-3 is the registry number for 4,4'-Methylenebis-benzen-2,6-d2-amine, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg, 5mg.
4-[(4-amino-3,5-dideuteriophenyl)methyl]-2,6-dideuterioaniline (CAS 145657-14-3) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 202.29 g/mol. IUPAC name: 4-[(4-amino-3,5-dideuteriophenyl)methyl]-2,6-dideuterioaniline. InChIKey: YBRVSVVVWCFQMG-KDWZCNHSSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 202.29 g/mol |
| IUPAC name | 4-[(4-amino-3,5-dideuteriophenyl)methyl]-2,6-dideuterioaniline |
| InChIKey | YBRVSVVVWCFQMG-KDWZCNHSSA-N |
| SMILES | [2H]C1=CC(=CC(=C1N)[2H])CC2=CC(=C(C(=C2)[2H])N)[2H] |
Computed by PubChem (NCBI)