CAS 1456707-65-5 is the registry number for Amorolfine Impurity 18. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(2S)-2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propan-1-ol (CAS 1456707-65-5) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: (2S)-2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propan-1-ol. InChIKey: YGTZHUMRZRLTKX-LBPRGKRZSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | (2S)-2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propan-1-ol |
| InChIKey | YGTZHUMRZRLTKX-LBPRGKRZSA-N |
| SMILES | CCC(C)(C)C1=CC=C(C=C1)C[C@H](C)CO |
Computed by PubChem (NCBI)