Products 1456707-65-5

CAS 1456707-65-5 is the registry number for Amorolfine Impurity 18. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(2S)-2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propan-1-ol (CAS 1456707-65-5) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: (2S)-2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propan-1-ol. InChIKey: YGTZHUMRZRLTKX-LBPRGKRZSA-N.

Identity
Molecular formulaC15H24O
Molecular weight220.35 g/mol
IUPAC name(2S)-2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propan-1-ol
InChIKeyYGTZHUMRZRLTKX-LBPRGKRZSA-N
SMILESCCC(C)(C)C1=CC=C(C=C1)C[C@H](C)CO

Computed by PubChem (NCBI)