Products 1458063-04-1
CAS 1458063-04-1 appears in our catalog under these names: Udonitrectag, Udonitrectag, 98.81%, Udonitrectag, 98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 100 mg, 10mM/1mL, 25 mg, 5 mg, 50 mg, 10 mg.
(1S,4R,5R,7S)-3,4-dibenzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxylic acid (CAS 1458063-04-1) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: (1S,4R,5R,7S)-3,4-dibenzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxylic acid. InChIKey: SEKGLVUAECPQQM-NHAYFPRASA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (1S,4R,5R,7S)-3,4-dibenzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxylic acid |
| InChIKey | SEKGLVUAECPQQM-NHAYFPRASA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H]2[C@@H]3O[C@@H]([C@H](O3)C(=O)O)C(=O)N2CC4=CC=CC=C4 |
Computed by PubChem (NCBI)