Products 145828-87-1

CAS 145828-87-1 is the registry number for 3-Ethoxy-5-formyl-2-hydroxybenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

3-ethoxy-5-formyl-2-hydroxybenzoic acid (CAS 145828-87-1) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 3-ethoxy-5-formyl-2-hydroxybenzoic acid. InChIKey: RIHUGGNPDCPWHQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O5
Molecular weight210.18 g/mol
IUPAC name3-ethoxy-5-formyl-2-hydroxybenzoic acid
InChIKeyRIHUGGNPDCPWHQ-UHFFFAOYSA-N
SMILESCCOC1=CC(=CC(=C1O)C(=O)O)C=O

Computed by PubChem (NCBI)