Products 1458652-57-7
CAS 1458652-57-7 is the registry number for (S)-4-Bromo-7-fluoro-2,3-dihydro-1H-inden-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-4-bromo-7-fluoro-2,3-dihydro-1H-inden-1-ol (CAS 1458652-57-7) is a chemical compound with the molecular formula C9H8BrFO and a molecular weight of 231.06 g/mol. IUPAC name: (1S)-4-bromo-7-fluoro-2,3-dihydro-1H-inden-1-ol. InChIKey: NLVVNRITLSLCDP-QMMMGPOBSA-N.
| Molecular formula | C9H8BrFO |
|---|---|
| Molecular weight | 231.06 g/mol |
| IUPAC name | (1S)-4-bromo-7-fluoro-2,3-dihydro-1H-inden-1-ol |
| InChIKey | NLVVNRITLSLCDP-QMMMGPOBSA-N |
| SMILES | C1CC2=C(C=CC(=C2[C@H]1O)F)Br |
Computed by PubChem (NCBI)