Products 146-76-9
CAS 146-76-9 is the registry number for 2-Bromoadenosine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 2mg, 10mg, 50mg, 25mg, Get quote.
(2R,3R,4S,5R)-2-(6-amino-2-bromopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 146-76-9) is a chemical compound with the molecular formula C10H12BrN5O4 and a molecular weight of 346.14 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-amino-2-bromopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: PGHYIISMDPKFKH-UUOKFMHZSA-N.
| Molecular formula | C10H12BrN5O4 |
|---|---|
| Molecular weight | 346.14 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-amino-2-bromopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | PGHYIISMDPKFKH-UUOKFMHZSA-N |
| SMILES | C1=NC2=C(N=C(N=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)Br)N |
Computed by PubChem (NCBI)