Products 847649-68-7
CAS 847649-68-7 is the registry number for 8-Bromo-3’-deoxyguanosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-8-bromo-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 847649-68-7) is a chemical compound with the molecular formula C10H12BrN5O4 and a molecular weight of 346.14 g/mol. IUPAC name: 2-amino-8-bromo-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: GYKHQPFPGSDWAF-JJXKXHSHSA-N.
| Molecular formula | C10H12BrN5O4 |
|---|---|
| Molecular weight | 346.14 g/mol |
| IUPAC name | 2-amino-8-bromo-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | GYKHQPFPGSDWAF-JJXKXHSHSA-N |
| SMILES | C1[C@H](O[C@H]([C@@H]1O)N2C3=C(C(=O)NC(=N3)N)N=C2Br)CO |
Computed by PubChem (NCBI)