Products 3001-47-6
CAS 3001-47-6 is the registry number for 2-Amino-8-bromo-9-(b-D-ribofuranosyl)purine. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg, 5000mg.
(2R,3R,4S,5R)-2-(2-amino-8-bromopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 3001-47-6) is a chemical compound with the molecular formula C10H12BrN5O4 and a molecular weight of 346.14 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(2-amino-8-bromopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: PVJSHZKOKYQDHE-UAKXSSHOSA-N.
| Molecular formula | C10H12BrN5O4 |
|---|---|
| Molecular weight | 346.14 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(2-amino-8-bromopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | PVJSHZKOKYQDHE-UAKXSSHOSA-N |
| SMILES | C1=C2C(=NC(=N1)N)N(C(=N2)Br)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)