CAS 146000-39-7 appears in our catalog under these names: Boc–N–Me–Aib–OH, N-BOC-N,2-Dimethylalanine, 98+%, Boc-N-Me-Aib-OH 97%, Boc-N-Me-Aib-OH, 97%, 97%, Boc-N-Methyl-Aminoisobutyric acid, 97%. Offered by: GLPBio, Thermo Scientific (Acros), Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 250mg, 15g, 2.5g.
2-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (CAS 146000-39-7) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: 2-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid. InChIKey: KPDLITGXUYMJEC-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 2-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| InChIKey | KPDLITGXUYMJEC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C(C)(C)C(=O)O |
Computed by PubChem (NCBI)