CAS 146060-18-6 is the registry number for (2S,4R)-1-((tert-Butoxy)carbonyl)-4-ethoxypyrrolidine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S,4R)-4-ethoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 146060-18-6) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: (2S,4R)-4-ethoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: UPAHQJOZYJQXQX-BDAKNGLRSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | (2S,4R)-4-ethoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | UPAHQJOZYJQXQX-BDAKNGLRSA-N |
| SMILES | CCO[C@@H]1C[C@H](N(C1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)