Products 1460737-79-4
CAS 1460737-79-4 appears in our catalog under these names: RobipseudinA, Robipseudin A. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxyphenyl]-3,5,7-trihydroxychromen-4-one (CAS 1460737-79-4) is a chemical compound with the molecular formula C25H26O6 and a molecular weight of 422.5 g/mol. IUPAC name: 2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxyphenyl]-3,5,7-trihydroxychromen-4-one. InChIKey: PKHWDTIYIZSVKD-VIZOYTHASA-N.
| Molecular formula | C25H26O6 |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | 2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxyphenyl]-3,5,7-trihydroxychromen-4-one |
| InChIKey | PKHWDTIYIZSVKD-VIZOYTHASA-N |
| SMILES | CC(=CCC/C(=C/CC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)/C)C |
Computed by PubChem (NCBI)
Synonyms:
Robipseudin A, orb1991025