Products 154992-17-3
CAS 154992-17-3 appears in our catalog under these names: Erysenegalensein E, Erysenegalensein E. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
5,7-dihydroxy-8-(2-hydroxy-3-methylbut-3-enyl)-3-(4-hydroxyphenyl)-6-(3-methylbut-2-enyl)chromen-4-one (CAS 154992-17-3) is a chemical compound with the molecular formula C25H26O6 and a molecular weight of 422.5 g/mol. IUPAC name: 5,7-dihydroxy-8-(2-hydroxy-3-methylbut-3-enyl)-3-(4-hydroxyphenyl)-6-(3-methylbut-2-enyl)chromen-4-one. InChIKey: ZXSXDAJQZZFAON-UHFFFAOYSA-N.
| Molecular formula | C25H26O6 |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | 5,7-dihydroxy-8-(2-hydroxy-3-methylbut-3-enyl)-3-(4-hydroxyphenyl)-6-(3-methylbut-2-enyl)chromen-4-one |
| InChIKey | ZXSXDAJQZZFAON-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=C2C(=C1O)C(=O)C(=CO2)C3=CC=C(C=C3)O)CC(C(=C)C)O)O)C |
Computed by PubChem (NCBI)