Products 92280-12-1
CAS 92280-12-1 appears in our catalog under these names: Sanggenon N, Sanggenon N. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5 mg, 1 mg.
5,7-dihydroxy-2-[5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-6-yl]-2,3-dihydrochromen-4-one (CAS 92280-12-1) is a chemical compound with the molecular formula C25H26O6 and a molecular weight of 422.5 g/mol. IUPAC name: 5,7-dihydroxy-2-[5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-6-yl]-2,3-dihydrochromen-4-one. InChIKey: PCZZLTRWCMPYNK-UHFFFAOYSA-N.
| Molecular formula | C25H26O6 |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | 5,7-dihydroxy-2-[5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-6-yl]-2,3-dihydrochromen-4-one |
| InChIKey | PCZZLTRWCMPYNK-UHFFFAOYSA-N |
| SMILES | CC(=CCCC1(C=CC2=C(O1)C=CC(=C2O)C3CC(=O)C4=C(C=C(C=C4O3)O)O)C)C |
Computed by PubChem (NCBI)