cas: 1461-97-8 — see every product listed under this CAS number, including other names
trans-DL-Cyclopentane-1,2-dicarboxylic acid, 98% (CAS 1461-97-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033882-250MG |
| cas | 1461-97-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 627.92 Pln | |
| Fluorochem | 10g | 1195.43 Pln | |
| Fluorochem | 25g | 2476.23 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Trans-(1R,2R)-cyclopentane-1,2-dicarboxylic acid (CAS 1461-97-8) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: trans-(1R,2R)-cyclopentane-1,2-dicarboxylic acid. InChIKey: ASJCSAKCMTWGAH-RFZPGFLSSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | trans-(1R,2R)-cyclopentane-1,2-dicarboxylic acid |
| InChIKey | ASJCSAKCMTWGAH-RFZPGFLSSA-N |
| SMILES | C1C[C@H]([C@@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)