Products 1461705-14-5
CAS 1461705-14-5 appears in our catalog under these names: 4-Chloro-2-methyl-6-nitrobenzoic acid, 95%, 4-Chloro-2-methyl-6-nitrobenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-chloro-2-methyl-6-nitrobenzoic acid (CAS 1461705-14-5) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 4-chloro-2-methyl-6-nitrobenzoic acid. InChIKey: XUPVOPCJDHFNAW-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 4-chloro-2-methyl-6-nitrobenzoic acid |
| InChIKey | XUPVOPCJDHFNAW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)