Products 10397-28-1

CAS 10397-28-1 appears in our catalog under these names: 4-Methoxy-3-nitrobenzoyl chloride, 95%, 4-Methoxy-3-nitrobenzoyl chloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

4-methoxy-3-nitrobenzoyl chloride (CAS 10397-28-1) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 4-methoxy-3-nitrobenzoyl chloride. InChIKey: FUXMQFBGQSNVBM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClNO4
Molecular weight215.59 g/mol
IUPAC name4-methoxy-3-nitrobenzoyl chloride
InChIKeyFUXMQFBGQSNVBM-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(=O)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)