CAS 10397-28-1 appears in our catalog under these names: 4-Methoxy-3-nitrobenzoyl chloride, 95%, 4-Methoxy-3-nitrobenzoyl chloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
4-methoxy-3-nitrobenzoyl chloride (CAS 10397-28-1) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 4-methoxy-3-nitrobenzoyl chloride. InChIKey: FUXMQFBGQSNVBM-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 4-methoxy-3-nitrobenzoyl chloride |
| InChIKey | FUXMQFBGQSNVBM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)