Products 73088-11-6
CAS 73088-11-6 appears in our catalog under these names: 2-(2-Chloro-4-nitrophenyl)acetic acid, 95%, 2–(2–Chloro–4–nitrophenyl)acetic Acid, 2-(2-Chloro-4-nitrophenyl)acetic Acid 98%, 2-(2-Chloro-4-nitrophenyl)acetic Acid 95%, 2-(2-Chloro-4-nitrophenyl)acetic Acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g, 100g, 500g, 10g.
2-(2-chloro-4-nitrophenyl)acetic acid (CAS 73088-11-6) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 2-(2-chloro-4-nitrophenyl)acetic acid. InChIKey: BYVVWINDBFSBQK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 2-(2-chloro-4-nitrophenyl)acetic acid |
| InChIKey | BYVVWINDBFSBQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)CC(=O)O |
Computed by PubChem (NCBI)