CAS 1461707-58-3 is the registry number for 5-Sulfamoyl-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-sulfamoyl-1,3-thiazole-4-carboxylic acid (CAS 1461707-58-3) is a chemical compound with the molecular formula C4H4N2O4S2 and a molecular weight of 208.2 g/mol. IUPAC name: 5-sulfamoyl-1,3-thiazole-4-carboxylic acid. InChIKey: MOHLHJGZEMOMJX-UHFFFAOYSA-N.
| Molecular formula | C4H4N2O4S2 |
|---|---|
| Molecular weight | 208.2 g/mol |
| IUPAC name | 5-sulfamoyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | MOHLHJGZEMOMJX-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(S1)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)