Products 1461707-58-3

CAS 1461707-58-3 is the registry number for 5-Sulfamoyl-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-sulfamoyl-1,3-thiazole-4-carboxylic acid (CAS 1461707-58-3) is a chemical compound with the molecular formula C4H4N2O4S2 and a molecular weight of 208.2 g/mol. IUPAC name: 5-sulfamoyl-1,3-thiazole-4-carboxylic acid. InChIKey: MOHLHJGZEMOMJX-UHFFFAOYSA-N.

Identity
Molecular formulaC4H4N2O4S2
Molecular weight208.2 g/mol
IUPAC name5-sulfamoyl-1,3-thiazole-4-carboxylic acid
InChIKeyMOHLHJGZEMOMJX-UHFFFAOYSA-N
SMILESC1=NC(=C(S1)S(=O)(=O)N)C(=O)O

Computed by PubChem (NCBI)