Products 1461708-14-4
CAS 1461708-14-4 appears in our catalog under these names: tert-Butyl N-(5-cyano-4-methyl-1,3-thiazol-2-yl)carbamate, 95%, tert-Butyl N-(5-cyano-4-methyl-1,3-thiazol-2-yl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl N-(5-cyano-4-methyl-1,3-thiazol-2-yl)carbamate (CAS 1461708-14-4) is a chemical compound with the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. IUPAC name: tert-butyl N-(5-cyano-4-methyl-1,3-thiazol-2-yl)carbamate. InChIKey: XDBJYBZATRIJLN-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O2S |
|---|---|
| Molecular weight | 239.30 g/mol |
| IUPAC name | tert-butyl N-(5-cyano-4-methyl-1,3-thiazol-2-yl)carbamate |
| InChIKey | XDBJYBZATRIJLN-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC(=O)OC(C)(C)C)C#N |
Computed by PubChem (NCBI)