CAS 2722199-73-5 is the registry number for 3-(2,3-Dihydro-1H-pyrazolo[4,3-b]pyridin-1-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,3-dihydropyrazolo[4,3-b]pyridin-1-yl)thiolane 1,1-dioxide (CAS 2722199-73-5) is a chemical compound with the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. IUPAC name: 3-(2,3-dihydropyrazolo[4,3-b]pyridin-1-yl)thiolane 1,1-dioxide. InChIKey: RLXDRORXVOZTOX-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O2S |
|---|---|
| Molecular weight | 239.30 g/mol |
| IUPAC name | 3-(2,3-dihydropyrazolo[4,3-b]pyridin-1-yl)thiolane 1,1-dioxide |
| InChIKey | RLXDRORXVOZTOX-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C3=C(CN2)N=CC=C3 |
Computed by PubChem (NCBI)