Products 1435973-52-6
CAS 1435973-52-6 is the registry number for 6-((Propyl-3,3,3-D₃)sulfonyl)-1H-benzo(d)imidazol-2-amine. Offered by: TRC. Available pack sizes: 100mg.
6-(3,3,3-trideuteriopropylsulfonyl)-1H-benzimidazol-2-amine (CAS 1435973-52-6) is a chemical compound with the molecular formula C10H13N3O2S and a molecular weight of 242.31 g/mol. IUPAC name: 6-(3,3,3-trideuteriopropylsulfonyl)-1H-benzimidazol-2-amine. InChIKey: WTPBIYSMFKUQKY-FIBGUPNXSA-N.
| Molecular formula | C10H13N3O2S |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | 6-(3,3,3-trideuteriopropylsulfonyl)-1H-benzimidazol-2-amine |
| InChIKey | WTPBIYSMFKUQKY-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CCS(=O)(=O)C1=CC2=C(C=C1)N=C(N2)N |
Computed by PubChem (NCBI)