CAS 1461715-76-3 appears in our catalog under these names: 7-Methoxy-3,4-dihydronaphthalene-2-sulfonamide, 95%, 7-Methoxy-3,4-dihydronaphthalene-2-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-methoxy-3,4-dihydronaphthalene-2-sulfonamide (CAS 1461715-76-3) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: 7-methoxy-3,4-dihydronaphthalene-2-sulfonamide. InChIKey: CPEWXXQAQCGRQD-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | 7-methoxy-3,4-dihydronaphthalene-2-sulfonamide |
| InChIKey | CPEWXXQAQCGRQD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CCC(=C2)S(=O)(=O)N)C=C1 |
Computed by PubChem (NCBI)