Products 1461727-01-4
CAS 1461727-01-4 is the registry number for Methyl 3-({(amino(4-bromophenyl)methylidene)amino}oxy)prop-2-enoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl (E)-3-[(Z)-[amino-(4-bromophenyl)methylidene]amino]oxyprop-2-enoate (CAS 1461727-01-4) is a chemical compound with the molecular formula C11H11BrN2O3 and a molecular weight of 299.12 g/mol. IUPAC name: methyl (E)-3-[(Z)-[amino-(4-bromophenyl)methylidene]amino]oxyprop-2-enoate. InChIKey: SNCNDOBWQGNBJM-VOTSOKGWSA-N.
| Molecular formula | C11H11BrN2O3 |
|---|---|
| Molecular weight | 299.12 g/mol |
| IUPAC name | methyl (E)-3-[(Z)-[amino-(4-bromophenyl)methylidene]amino]oxyprop-2-enoate |
| InChIKey | SNCNDOBWQGNBJM-VOTSOKGWSA-N |
| SMILES | COC(=O)/C=C/O/N=C(/C1=CC=C(C=C1)Br)\N |
Computed by PubChem (NCBI)