CAS 146196-07-8 appears in our catalog under these names: Inosine Impurity 1, Inosine Impurity 3, 2-Chloro-2'-deoxy-6-O-methylinosine. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 100mg, Get quote.
(2R,3S,5R)-5-(2-chloro-6-methoxypurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (CAS 146196-07-8) is a chemical compound with the molecular formula C11H13ClN4O4 and a molecular weight of 300.70 g/mol. IUPAC name: (2R,3S,5R)-5-(2-chloro-6-methoxypurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol. InChIKey: SHECDAHTEBGANH-RRKCRQDMSA-N.
| Molecular formula | C11H13ClN4O4 |
|---|---|
| Molecular weight | 300.70 g/mol |
| IUPAC name | (2R,3S,5R)-5-(2-chloro-6-methoxypurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | SHECDAHTEBGANH-RRKCRQDMSA-N |
| SMILES | COC1=NC(=NC2=C1N=CN2[C@H]3C[C@@H]([C@H](O3)CO)O)Cl |
Computed by PubChem (NCBI)