Products 680212-58-2
CAS 680212-58-2 is the registry number for 1-(4-Chloro-3-nitrophenyl)-3-morpholinourea, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-chloro-3-nitrophenyl)-3-morpholin-4-ylurea (CAS 680212-58-2) is a chemical compound with the molecular formula C11H13ClN4O4 and a molecular weight of 300.70 g/mol. IUPAC name: 1-(4-chloro-3-nitrophenyl)-3-morpholin-4-ylurea. InChIKey: JVESNKLVIFGDNL-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN4O4 |
|---|---|
| Molecular weight | 300.70 g/mol |
| IUPAC name | 1-(4-chloro-3-nitrophenyl)-3-morpholin-4-ylurea |
| InChIKey | JVESNKLVIFGDNL-UHFFFAOYSA-N |
| SMILES | C1COCCN1NC(=O)NC2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)