Products 346638-16-2
CAS 346638-16-2 is the registry number for Ethyl 2-(8-chloro-1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-7H-purin-7-yl)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (CAS 346638-16-2) is a chemical compound with the molecular formula C11H13ClN4O4 and a molecular weight of 300.70 g/mol. IUPAC name: ethyl 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate. InChIKey: JZZKOLZPXLCWMA-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN4O4 |
|---|---|
| Molecular weight | 300.70 g/mol |
| IUPAC name | ethyl 2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
| InChIKey | JZZKOLZPXLCWMA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C2=C(N=C1Cl)N(C(=O)N(C2=O)C)C |
Computed by PubChem (NCBI)