CAS 345264-15-5 is the registry number for 2-Boc-1,2,3,4-tetrahydropyrrolo[3,2,1-jk][1,4]benzodiazepine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 1,10-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-10-carboxylate (CAS 345264-15-5) is a chemical compound with the molecular formula C16H20N2O2 and a molecular weight of 272.34 g/mol. IUPAC name: tert-butyl 1,10-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-10-carboxylate. InChIKey: RIHZGAGJTRQKPW-UHFFFAOYSA-N.
| Molecular formula | C16H20N2O2 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | tert-butyl 1,10-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-10-carboxylate |
| InChIKey | RIHZGAGJTRQKPW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C=CC3=C2C(=CC=C3)C1 |
Computed by PubChem (NCBI)