CAS 339100-33-3 is the registry number for 1-(4-[(2E)-3-(Dimethylamino)prop-2-enoyl]phenyl)-3,3-dimethylazetidin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[4-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]-3,3-dimethylazetidin-2-one (CAS 339100-33-3) is a chemical compound with the molecular formula C16H20N2O2 and a molecular weight of 272.34 g/mol. IUPAC name: 1-[4-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]-3,3-dimethylazetidin-2-one. InChIKey: WPVJMQGWNSBWJG-MDZDMXLPSA-N.
| Molecular formula | C16H20N2O2 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1-[4-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]-3,3-dimethylazetidin-2-one |
| InChIKey | WPVJMQGWNSBWJG-MDZDMXLPSA-N |
| SMILES | CC1(CN(C1=O)C2=CC=C(C=C2)C(=O)/C=C/N(C)C)C |
Computed by PubChem (NCBI)