CAS 331763-49-6 is the registry number for (4R,5S)-4-{[(tert-butoxy)carbonyl]amino}-5-methylheptanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(4R,5S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid (CAS 331763-49-6) is a chemical compound with the molecular formula C13H25NO4 and a molecular weight of 259.34 g/mol. IUPAC name: (4R,5S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid. InChIKey: AHJOCXORPOFIQH-VHSXEESVSA-N.
| Molecular formula | C13H25NO4 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | (4R,5S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid |
| InChIKey | AHJOCXORPOFIQH-VHSXEESVSA-N |
| SMILES | CC[C@H](C)[C@@H](CCC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)