CAS 146533-41-7 appears in our catalog under these names: Macitentan Impurity 44, 5-(4-Bromophenyl)-4,6-dichloropyrimidine, 5-(4-Bromophenyl)-4,6-dichloropyrimidine, >98.0%(GC), 5-(4-Bromophenyl)-4,6-dichloropyrimidine 97%, 5-(4-Bromophenyl)-4,6-dichloropyrimidine, 95%, 95%. Offered by: Chemat Brand, TRC, TCI, Ambeed, Chemat. Available pack sizes: on request, 25g, 1g, 5g, 10g, 100g, 500g.
5-(4-bromophenyl)-4,6-dichloropyrimidine (CAS 146533-41-7) is a chemical compound with the molecular formula C10H5BrCl2N2 and a molecular weight of 303.97 g/mol. IUPAC name: 5-(4-bromophenyl)-4,6-dichloropyrimidine. InChIKey: WEEFLZORZXLIJE-UHFFFAOYSA-N.
| Molecular formula | C10H5BrCl2N2 |
|---|---|
| Molecular weight | 303.97 g/mol |
| IUPAC name | 5-(4-bromophenyl)-4,6-dichloropyrimidine |
| InChIKey | WEEFLZORZXLIJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(N=CN=C2Cl)Cl)Br |
Computed by PubChem (NCBI)